Wy-14643
Wy-14643 is an agonist of PPARα with EC50 of 0.63 μM that can decrease the inflammatory response. It has other functions including lipid metabolism, cell proliferation, differentiation, adipogenesis etc..
| Trivial name | Pirinixic Acid; NSC 310038 |
| Catalog Number | CSN12217 |
| Alternative Name(s) | Pirinixic Acid; NSC 310038 |
| Research Area | Cardiovascular Disease|Metabolic Disease |
| Molecular Formula | C14H14ClN3O2S |
| CAS# | 50892-23-4 |
| Purity | ≥99% |
| SMILES | O=C(O)CSC1=NC(NC2=CC=CC(C)=C2C)=CC(Cl)=N1 |
| Size | 50mg |
| Supplier Page | https://www.csnpharm.com/products/wy-14643.html |