Oleanolic Acid 500mg
Oleanolic acid (Caryophyllin) is a naturally occurring triterpenoid, widely distributed in food and medicinal plants, related to betulinic acid. It is relatively non-toxic, antitumor, and hepatoprotective, as well as exhibiting antiviral properties.
| Trivial name | Oleanolic Acid 500mg |
| Catalog Number | A10668-500 |
| Alternative Name(s) | 3??-?€?hydroxy-?€?olean-?€?12-?€?en-?€?28-?€?oic acid |
| Molecular Formula | C30H48O3 |
| CAS# | 508-02-1 |
| SMILES | C[C@]12CC[C@@H](C([C@@H]1CC[C@@]3([C@@H]2CC=C4[C@]3(CC[C@@]5([C@H]4CC(CC5)(C)C)C(=O)O)C)C)(C)C)O |
| Size | 500mg |
| Supplier Page | http://www.adooq.com/oleanolic-acid-caryophyllin.html |
