TPCA-1 10mM * 1mL in DMSO
TPCA-1 is a potent and selective inhibitor of human I??B kinase-2 (IKK-2) with IC50 = 17.9 nM for IKK-2 compared to 400nm for IKK-1.
| Trivial name | TPCA-1 10mM * 1mL in DMSO |
| Catalog Number | A11579-10mM-D |
| Alternative Name(s) | 2-[(Aminocarbonyl)amino]-5-(4-fluorophenyl)-3-thiophenecarboxamide |
| Molecular Formula | C12H10FN3O2S |
| CAS# | 507475-17-4 |
| SMILES | C1=CC(=CC=C1C2=CC(=C(S2)NC(=O)N)C(=O)N)F |
| Size | 10mM * 1mL in DMSO |
| Supplier Page | http://www.adooq.com/tpca-1.html |
