Halometasone
API Standards
| Trivial name | NULL |
| Catalog Number | CS-O-30596 |
| Alternative Name(s) | (6a,11,16a)-2-Chloro-6,9-difluoro-11,17,21-trihydroxy-16-methylpregna-1,4-diene-3,20-dione; 2-Chloroflumethasone; Ba 48401; C 48401Ba; Halomethasone; Sicorten; 2-Chloro-6a,9-difluoro-11,17,21-trihydroxy-16a-methylpregna-1,4-diene-3,20-dione; |
| Research Area | A corticosteroid used in the treatment of skin disorders such as chronic eczema. |
| Molecular Formula | C22H27ClF2O5 |
| CAS# | 50629-82-8 |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | F[C@@]1([C@]2(C=C3Cl)C)[C@](C[C@H](F)C2=CC3=O)([H])[C@@](C[C@@H](C)[C@]4(O)C(CO)=O)([H])[C@]4(C)C[C@@H]1O |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO30596.html |
| Additional Information | NULL |