γ-Linolenic Acid (18:3,N-6)
γ-Linolenic acid, an unsaturated fatty acid synthesized from linoleic acid (LA) by the enzyme delta-6-desaturase, inhibits inflammatory responses through inactivation of NFκB and activator protein-1 by suppressed oxidative stress.
| Trivial name | / |
| Catalog Number | CSN11078 |
| Alternative Name(s) | / |
| Research Area | / |
| Molecular Formula | C18H30O2 |
| CAS# | 506-26-3 |
| Purity | ≥98% |
| SMILES | CCCCC/C=C\C/C=C\C/C=C\CCCCC(O)=O |
| Size | 1g |
| Supplier Page | https://www.csnpharm.com/products/r-linolenic-acid-(18:3,n-6).html |
