p-Bromofluorobenzene D4
Stable Isotopes
| Trivial name | NULL |
| Catalog Number | CS-O-10303 |
| Alternative Name(s) | 1-bromo-4-fluoro(D4)benzene |
| Research Area | p-Bromofluorobenzene-d4 is the isotope labelled analog of p-Bromofluorobenzene ; a dihalogenated benzene used in the preparation of pharmaceutical compounds such as atypical antipsychotic agents. |
| Molecular Formula | C6D4BrF |
| CAS# | 50592-31-9 |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | BrC(C([2H])=C1[2H])=C(C([2H])=C1F)[2H] |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO10303.html |
| Additional Information | NULL |