(1R,3S)-Compound E | MedChemExpress (MCE)
(1R,3S)-Compound E is the inactive isomer of Compound E (HY-14176), and can be used as an experimental control. Compound E is a γ-secretase inhibitor. Compound E bloks β-amyloid(40), β-amyloid(42), and Notch γ-secretase cleavage with IC50s of 0.24, 0.37, 0.32 nM, respectively.
| Trivial name | (1R,3S)-Compound E |
| Catalog Number | HY-14176A |
| Research Area | Cancer |
| CAS# | 504428-17-5 |
| Purity | ≥98.00% |
| SMILES | FC1=CC(F)=CC(CC(N[C@H](C)C(N[C@H]2N=C(C3=CC=CC=C3)C4=CC=CC=C4N(C2=O)C)=O)=O)=C1 |
| PubChem Chemical Structure ID | 68274344 |
| Size | 5 mg |
| Supplier Page | https://www.medchemexpress.com/1r-3s-compound-e.html |