Cefadroxil
Cefadroxil is the first-generation Cephalosporin antibiotic, which exerts bactericidal activity by interfering with the later stages of bacterial cell wall synthesis through inactivation of one or more penicillin-binding proteins and inhibiting cross-linking of the peptidoglycan structure.
| Trivial name | BL-S 578 |
| Catalog Number | CSN10561 |
| Alternative Name(s) | BL-S 578 |
| Research Area | Infection |
| Molecular Formula | C16H17N3O5S |
| CAS# | 50370-12-2 |
| Purity | ≥98% |
| SMILES | O=C(C(N12)=C(C)CS[C@]2([H])[C@H](NC([C@H](N)C3=CC=C(O)C=C3)=O)C1=O)O |
| Size | 100mg |
| Supplier Page | https://www.csnpharm.com/products/cefadroxil.html |