Apixaban
API Standard
| Catalog Number | CS-O-00932 |
| Alternative Name(s) | 1-(4-methoxyphenyl)-7-oxo-6-[4-(2-oxopiperidin-1-yl)phenyl]-1H,4H,5H,6H,7H-pyrazolo[3boxamide;CS-CW-00111 |
| Research Area | Apixaban is an orally active inhibitor of coagulation factor Xa with anticoagulant activity. Apixaban directly inhibits factor Xa, thereby interfering with the conversion of prothrombin to thrombin and preventing formation of cross-linked fibrin clots. |
| Molecular Formula | C25H25N5O4 |
| CAS# | 503612-47-3 |
| Purity | >98% |
| SMILES | O=C(N(C1=CC=C(N(CCCC2)C2=O)C=C1)CC3)C4=C3C(C(N)=O)=NN4C5=CC=C(OC)C=C5 |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO00932.html |