Apixaban 50mg
Apixaban is an anticoagulant for the prevention of venous thromboembolism and venous thromboembolic events.
| Trivial name | Apixaban 50mg |
| Catalog Number | A10082-50 |
| Alternative Name(s) | 1-(4-methoxyphenyl)-7-oxo-6-[4-(2-oxopiperidin-1-yl)phenyl]-4,5-dihydropyrazolo[5,4-c]pyridine-3-carboxamide |
| Molecular Formula | C25H25N5O4 |
| CAS# | 503612-47-3 |
| SMILES | COC1=CC=C(C=C1)N2C3=C(CCN(C3=O)C4=CC=C(C=C4)N5CCCCC5=O)C(=N2)C(=O)N |
| Size | 50mg |
| Supplier Page | http://www.adooq.com/apixaban.html |
