NU-7441 (KU-57788) 10mg
NU-7441 (KU-57788) is a potent and selective DNA-dependent protein kinase (DNA-PK) inhibitor. The IC50 values are 14, 1700, 5000, >100000 and >100000 nM for DNA-PK, mTOR, PI 3-K, ATM and ATR respectively.
| Trivial name | NU-7441 (KU-57788) 10mg |
| Catalog Number | A11098-10 |
| Alternative Name(s) | 8-(4-Dibenzothienyl)-2-(4-morpholinyl)-4H-1-benzopyran-4-one |
| Molecular Formula | C25H19NO3S |
| CAS# | 503468-95-9 |
| SMILES | C1COCCN1C2=CC(=O)C3=C(O2)C(=CC=C3)C4=CC=CC5=C4SC6=CC=CC=C56 |
| Size | 10mg |
| Supplier Page | http://www.adooq.com/nu-7441-ku-57788.html |
