Methyl 4-Hydroxybenzoate Sodium salt
Solparol (sodium methyl para-hydroxybenzoate) is a compound with formula Na(CH3(C6H4COO)O). It is the sodium salt of methylparaben.It is a food additive with the E number E219 which is used as a preservative.
| Catalog Number | CDC10-0368 |
| Alternative Name(s) | sodium,4-methoxycarbonylphenolate;Methyl 4-hydroxybenzoate,sodium salt;Sodium methyl 4-hydroxybenzoate;Sodium 4-(methoxycarbonyl)phenolate;Methylis parahydroxybenzoas natricum; |
| Research Area | Used for research and manufacturing |
| Molecular Formula | C8H7NaO3 |
| CAS# | 5026-62-0 |
| Inchi | 1S/C8H8O3.Na/c1-11-8(10)6-2-4-7(9)5-3-6;/h2-5,9H,1H3;/q;+1/p-1 |
| SMILES | [Na+].COC(=O)c1ccc([O-])cc1 |
| Size | inquire |
| Supplier Page | https://www.formulationbio.com/methyl-4-hydroxybenzoate-sodium-salt-item-2450.html |