Lycopene
Lycopene is a red-colored carotenoid found in tomatoes and other red fruits and vegetables. Carotenoids are powerful antioxidants that efficiently quench singlet oxygen, may paly a role in prevention cancers, cardiovascular stress, and other diseases.
| Trivial name | NSC 407322 |
| Catalog Number | CSN23621 |
| Alternative Name(s) | NSC 407322 |
| Research Area | / |
| Molecular Formula | C40H56 |
| CAS# | 502-65-8 |
| Purity | ≥98% |
| SMILES | CC(C)=CCC/C(C)=C/C=C/C(C)=C/C=C/C(C)=C/C=C/C=C(C)/C=C/C=C(C)/C=C/C=C(C)/CCC=C(C)C |
| Size | 5mg |
| Supplier Page | https://www.csnpharm.com/products/lycopene.html |
