S3I-201 (NSC 74859) 10mM * 1mL in DMSO
S3I-201 (NSC 74859) is a novel inhibitor of Stat3 that inhibits Stat3, Stat3 complex formation and Stat3-DNA binding activity in vitro (IC50 = 86 ?? 33 ??M) and Stat3-dependent transcriptional activities.
Trivial name | S3I-201 (NSC 74859) 10mM * 1mL in DMSO |
Catalog Number | A10817-10mM-D |
Alternative Name(s) | 2-hydroxy-4-(2-(tosyloxy)acetamido)benzoic acid |
Molecular Formula | C₁₆H₁₅NO₇S |
CAS# | 501919-59-1 |
SMILES | CC1=CC=C(C=C1)S(=O)(=O)OCC(=O)NC2=CC(=C(C=C2)C(=O)O)O |
Size | 10mM * 1mL in DMSO |
Supplier Page | http://www.adooq.com/s3i-201-nsc-74859.html |