S3I-201 10mg
S3I-201 (NSC 74859) is a novel inhibitor of Stat3 that inhibits Stat3, Stat3 complex formation and Stat3-DNA binding activity in vitro (IC50 = 86 ?? 33 ??M) and Stat3-dependent transcriptional activities.
| Trivial name | S3I-201 10mg |
| Catalog Number | A10817-10 |
| Alternative Name(s) | 2-hydroxy-4-(2-(tosyloxy)acetamido)benzoic acid |
| Molecular Formula | C16H15NO7S |
| CAS# | 501919-59-1 |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)OCC(=O)NC2=CC(=C(C=C2)C(=O)O)O |
| Size | 10mg |
| Supplier Page | http://www.adooq.com/s3i-201-nsc-74859.html |
