BI-D1870 5mg
BI-D1870 is a potent and specific inhibitor of the p90 ribosomal S6 kinase (RSK) isoforms in vitro and in vivo, which inhibits RSK1, RSK2, RSK3 and RSK4 in vitro with an IC50 of 10?€?30 nM.
| Trivial name | BI-D1870 5mg |
| Catalog Number | A12452-5 |
| Alternative Name(s) | 2-[(3,5-Difluoro-4-hydroxyphenyl)amino]-7,8-dihydro-5,7-dimethyl-8-(3-methylbutyl)-6(5H)-pteridone |
| Molecular Formula | C19H23F2N5O2 |
| CAS# | 501437-28-1 |
| SMILES | CC1C(=O)N(C2=CN=C(N=C2N1CCC(C)C)NC3=CC(=C(C(=C3)F)O)F)C |
| Size | 5mg |
| Supplier Page | http://www.adooq.com/bi-d1870.html |
