Trans-4-Hydroxycinnamic Acid
Trans-4-Hydroxycinnamic acid, a natural product isolated and purified from the herb of Trifolium pratense, has anti-bacteria effect against some Gram-positive and Gram-negative bacteria, at IC50 concentrations of 100-170mg/mL, respectively.
| Trivial name | p-Coumaric Acid |
| Catalog Number | CSN18838 |
| Alternative Name(s) | p-Coumaric Acid |
| Research Area | / |
| Molecular Formula | C9H8O3 |
| CAS# | 501-98-4 |
| Purity | ≥99% |
| SMILES | O=C(O)/C=C/C1=CC=C(O)C=C1 |
| Size | 1g |
| Supplier Page | https://www.csnpharm.com/products/trans-4-hydroxycinnamic-acid.html |
