Resveratrol
API Standard
| Catalog Number | CS-O-02277 |
| Alternative Name(s) | 5-[(1E)-2-(4-Hydroxyphenyl)ethenyl]-1,3-benzenediol;(E)-5-(4-hydroxystyryl)benzene-1,3-diol |
| Research Area | Resveratrol is a phytoalexin derived from grapes and other food products with antioxidant and potential chemopreventive activities. Resveratrol induces phase II drug-metabolizing enzymes (anti-initiation activity); mediates anti-inflammatory effects and i |
| Molecular Formula | C14H12O3 |
| CAS# | 501-36-0 |
| Purity | >98% |
| SMILES | OC1=CC(O)=CC(/C=C/C2=CC=C(O)C=C2)=C1 |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO02277.html |