Resveratrol 200mg
Resveratrol is a stilbenoid, a type of natural phenol, and a phytoalexin produced naturally by several plants when under attack by pathogens such as bacteria or fungi.
| Trivial name | Resveratrol 200mg |
| Catalog Number | A10785-200 |
| Alternative Name(s) | 3,5,4'-trihydroxy-trans-stilbene |
| Molecular Formula | C14H12O3 |
| CAS# | 501-36-0 |
| SMILES | C1=CC(=CC=C1/C=C/C2=CC(=CC(=C2)O)O)O |
| Size | 200mg |
| Supplier Page | http://www.adooq.com/resveratrol.html |
