Resveratrol 1g
Resveratrol is a stilbenoid, a type of natural phenol, and a phytoalexin produced naturally by several plants when under attack by pathogens such as bacteria or fungi.
Trivial name | Resveratrol 1g |
Catalog Number | A10785-1000 |
Alternative Name(s) | 3,5,4'-trihydroxy-trans-stilbene |
Molecular Formula | C₁₄H₁₂O₃ |
CAS# | 501-36-0 |
SMILES | C1=CC(=CC=C1/C=C/C2=CC(=CC(=C2)O)O)O |
Size | 1000mg |
Supplier Page | http://www.adooq.com/resveratrol.html |