tat-nr2b9c
Tat-NR2B9c (Tat-NR2Bct, NA-1) is a postsynaptic density-95 (PSD-95) inhibitor, with EC50 values of 6.7 nM and 670 nM for PSD-95d2 (PSD-95 PDZ domain 2) and PSD-95d1, respectively, and disrupts the PSD-95/NMDAR interaction, inhibiting NR2A and NR2B binding to PSD-95 with IC50 values of 0.5 μM and 8 μM, respectively, also inhibits neuronal nitric oxide synthase (nNOS)/PSD-95 interaction, and possesses neuroprotective efficacy.
| Catalog Number | P1220 |
| Molecular Formula | C105H188N42O30 |
| CAS# | 500992-11-0 |
| Inchi | #N/A |
| Inchi Key | #N/A |
| SMILES | CCC(C)C(NC(=O)C(CO)NC(=O)C(CO)NC(=O)C(CC(C)C)NC(=O)C(CCCCN)NC(=O)C(CCCNC(N)=N)NC(=O)C(CCCNC(N)=N)NC(=O)C(CCCNC(N)=N)NC(=O)C(CCC(N)=O)NC(=O)C(CCCNC(N)=N)NC(=O)C(CCCNC(N)=N)NC(=O)C(CCCCN)NC(=O)C(CCCCN)NC(=O)C(CCCNC(N)=N)NC(=O)CNC(=O)C(N)CC1=CC=C(O)C=C1)C(=O)NC(CCC(O)=O)C(=O)NC(CO)C(=O)NC(CC(O)=O)C(=O)NC(C(C)C)C(O)=O |
| Size | 5mg |
| Supplier Page | http://www.selleckchem.com/peptide/tat-nr2b9c.html |
| Additional Information | https://file.selleck.cn/downloads/struct/p1220-tat-nr2b9c-nerinetide-na-1-chemical-structure.gif |