GANT61 10mM * 1mL in DMSO
GANT61 is an inhibitor for GLI1 as well as GLI2-induced transcription, inhibits hedgehog with IC50 of 5 ??M, displays selectivity over other pathways, such as TNF and glucocorticoid receptor gene transactivation.
| Trivial name | GANT61 10mM * 1mL in DMSO |
| Catalog Number | A13252-10mM-D |
| Alternative Name(s) | 2,2'-[[Dihydro-2-(4-pyridinyl)-1,3(2?H,4H)-pyrimidinediyl]bis(methylene)]bis[N,N-dimeth?ylbenzenamine |
| Molecular Formula | C27H35N5 |
| CAS# | 500579-04-4 |
| SMILES | CN(C)C1=CC=CC=C1CN2CCCN(C2C3=CC=NC=C3)CC4=CC=CC=C4N(C)C |
| Size | 10mM * 1mL in DMSO |
| Supplier Page | http://www.adooq.com/gant61.html |
