Rilpivirine 10mM * 1mL in DMSO
Rilpivirine is a second-generation non-nucleoside reverse transcriptase inhibitor (NNRTI) with higher potency, longer half-life and reduced side-effect profile compared with older NNRTIs, such as efavirenz.
| Trivial name | Rilpivirine 10mM * 1mL in DMSO |
| Catalog Number | A11542-10mM-D |
| Alternative Name(s) | 4-[[4-[[4-[(1E)-2-Cyanoethenyl]-2,6-dimethylphenyl]amino]-2-pyrimidinyl]amino]benzonitrile |
| Molecular Formula | C22H18N6 |
| CAS# | 500287-72-9 |
| SMILES | CC1=CC(=CC(=C1NC2=NC(=NC=C2)NC3=CC=C(C=C3)C#N)C)/C=C/C#N |
| Size | 10mM * 1mL in DMSO |
| Supplier Page | http://www.adooq.com/rilpivirine.html |
