yangonin
Yangonin (Y100550) is a novel CB receptor ligand, it exhibits affinity for the human recombinant CB receptor. Yangonin (Y100550) could be a valuable candidate for the intervention of NF-κB-dependent pathological conditions such as inflammation.
| Catalog Number | T3S0738 |
| Alternative Name(s) | Y100550 |
| Research Area | Autophagy|||NF-Κb|||GPCR/G Protein |
| Molecular Formula | C15H14O4 |
| CAS# | 500-62-9 |
| Purity | 98.00% |
| SMILES | COc1ccc(cc1)\C=C\c1cc(OC)cc(=O)o1 |
| Size | 10 mg |
| Supplier Page | https://www.targetmol.com/compound/yangonin |
| Additional Information | https://www.targetmol.com/datasheet/T3S0738 |