Nordihydroguaiaretic acid 1000mg
Nordihydroguaiaretic acid is a natural phenolic compound isolated from the creosote bush Larrea divaricata, which has anti-tumor activities both in vitro and in vivo. Its analogs are in clinical development for use in refractory solid tumors.
| Trivial name | Nordihydroguaiaretic acid 1000mg |
| Catalog Number | A15190-1000 |
| Alternative Name(s) | 4-[4-(3,4-dihydroxyphenyl)-2,3-dimethylbutyl]benzene-1,2-diol |
| Molecular Formula | C18H22O4 |
| CAS# | 500-38-9 |
| SMILES | CC(CC1=CC(=C(C=C1)O)O)C(C)CC2=CC(=C(C=C2)O)O |
| Size | 1000mg |
| Supplier Page | http://www.adooq.com/nordihydroguaiaretic-acid.html |
