Floxuridine (FUDR)
Floxuridine (FUDR) is a prodrug that is rapidly catabolized to 5-fluorouracil in vivo. Floxuridine is used to treat various cancers, particularly metastases to the liver. Floxuridine inhibits Poly(ADP-Ribose) polymerase and induces DNA damage and apoptosis. Floxuridine has antiviral effects against HSV and CMV.
| Trivial name | NSC 27640, Deoxyfluorouridine |
| Catalog Number | S1299 |
| Molecular Formula | C20H17FN2O3S |
| CAS# | 50-91-9 |
| Inchi | InChI=1S/C20H17FN2O3S/c1-14-12-16(15-8-4-2-5-9-15)13-18(19(14)21)20(24)22-23-27(25,26)17-10-6-3-7-11-17/h2-13,23H,1H3,(H,22,24) |
| Inchi Key | PHHZKBMVRPULAW-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC(=C1F)C(=O)NNS(=O)(=O)C2=CC=CC=C2)C3=CC=CC=C3 |
| Size | 50mg |
| Supplier Page | http://www.selleckchem.com/products/Floxuridine.html |
| Additional Information | https://file.selleck.cn/downloads/struct/Floxuridine-Fludara-chemical-structure-S1299.gif |