Floxuridine
Floxuridine is an oncology drug that belongs to antimetabolites with an GI50 of 5.1 μM for the inhibition of PEPT1.
| Trivial name | Deoxyfluorouridine; FDUR; NSC-27640; 5-Fluorouracil 2'-Deoxyriboside |
| Catalog Number | CSN18715 |
| Alternative Name(s) | Deoxyfluorouridine; FDUR; NSC-27640; 5-Fluorouracil 2'-Deoxyriboside |
| Research Area | Cancer |
| Molecular Formula | C9H11FN2O5 |
| CAS# | 50-91-9 |
| Purity | ≥99% |
| SMILES | OC[C@@H]1[C@H](C[C@H](N2C(NC(C(F)=C2)=O)=O)O1)O |
| Size | 100mg |
| Supplier Page | https://www.csnpharm.com/products/floxuridine.html |
