L-Ascorbic acid
Also known as Vitamin C, Ascorbic acid functions as a powerful antioxidant, particularly in regards to reactive oxygen species (ROS). It functions as an enzymatic cofactor for multiple enzymes, serving as an electron donor for monooxygenases and dioxygenases. Also enhances iPSC generation from both mouse and human somatic cells.
Catalog Number | ABA-024 |
Alternative Name(s) | L-Threoascorbic acid, Antiscorbutic factor, Vitamin C |
CAS# | 50-81-7 |
Inchi | InChI=1S/C6H8O6/c7-1-2(8)5-3(9)4(10)6(11)12-5/h2,5,7-10H,1H2/t2-,5+/m0/s1 |
Inchi Key | CIWBSHSKHKDKBQ-JLAZNSOCSA-N |
SMILES | C(C(C1C(=C(C(=O)O1)O)O)O)O |
Size | Inquiry |
Supplier Page | https://www.agingclocks.com/l-ascorbic-acid-item-1391.html |