Ascorbic acid
API Standard
| Trivial name | NULL |
| Catalog Number | CS-O-00843 |
| Alternative Name(s) | 2-(1,2-dihydroxyethyl)-4,5-dihydroxyfuran-3(2H)-one; L-Ascorbic acid; L-Threoascorbic acid; Antiscorbutic factor; Vitamin C |
| Research Area | Physiological antioxidant. Coenzyme for a number of hydroxylation reactions; required for collagen synthesis. Widely distributed in plants and animals. Inadequate intake results in deficiency syndromes such as scurvy. |
| Molecular Formula | C6H8O6 |
| CAS# | 50-81-7 |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | O[C@H]([C@](O1)([H])C(O)=C(O)C1=O)CO |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO00843.html |
| Additional Information | NULL |