Actinomycin D 25mg
Actinomycin D is a metabolite isolated from Streptomyces parvulus that binds to the GpC steps of DNA. The compound acts as an antibiotic and is more effective against gram-positive bacteria than gram negative bacteria.
| Trivial name | Actinomycin D 25mg |
| Catalog Number | A13239-25 |
| Alternative Name(s) | 2-Amino-(N,N)-1-bis(hexadecahydro-6?,13-diisopropyl-2,5,9-trimethyl-1,4,7,11,14-pentao?xo-1H-pyrrolo[2,1]-[1,4,7,10,13] oxatetraazacyclohexadecin-10-yl)-4,6-dimethyl-3-ox?o-3H-phenoxazine-1,9-dicarboxamide |
| Molecular Formula | C62H86N12O16 |
| CAS# | 50-76-0 |
| SMILES | CC1C(C(=O)NC(C(=O)N2CCCC2C(=O)N(CC(=O)N(C(C(=O)O1)C(C)C)C)C)C(C)C)NC(=O)C3=C4C(=C(C=C3)C)OC5=C(C(=O)C(=C(C5=N4)C(=O)NC6C(OC(=O)C(N(C(=O)CN(C(=O)C7CCCN7C(=O)C(NC6=O)C(C)C)C)C)C(C)C)C)N)C |
| Size | 25mg |
| Supplier Page | http://www.adooq.com/actinomycin-d.html |
