D-Sorbitol, for cell culture | MedChemExpress (MCE)
D-Sorbitol, for cell culture (D-Glucitol, for cell culture) is a biochemical reagent that can be used as a biological material or organic compound for life science related research[1].
| Trivial name | D-Sorbitol, for cell culture |
| Catalog Number | HY-B0400B |
| Alternative Name(s) | D-Glucitol, for cell culture; D-Sorbitol |
| Research Area | Others |
| CAS# | 50-70-4 |
| Purity | ≥98.0% |
| SMILES | OC[C@@H]([C@H]([C@@H]([C@@H](CO)O)O)O)O |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/d-sorbitol-for-cell-culture.html |