Estradiol Benzoate
Estradiol benzoate is an estradiol analog which binds to the human, murine and chicken ERα with IC50 of 22-28 nM.
| Trivial name | Agofollin; Diffollisterol; Progynon B |
| Catalog Number | CSN10935 |
| Alternative Name(s) | Agofollin; Diffollisterol; Progynon B |
| Research Area | Endocrinology |
| Molecular Formula | C25H28O3 |
| CAS# | 50-50-0 |
| Purity | ≥99% |
| SMILES | O[C@H]1CC[C@@]2([H])[C@]3([H])CCC4=C(C=CC(OC(C5=CC=CC=C5)=O)=C4)[C@@]3([H])CC[C@]12C |
| Size | 1g |
| Supplier Page | https://www.csnpharm.com/products/estradiol-benzoate.html |
