Adiphenine HCl 10mM * 1mL in DMSO
Adiphenine is a local anaesthetics that has been shown to decrease the affinity of the AChR for ACh, which has been interpreted as shifting the equilibrium in favour of the resting state.
| Trivial name | Adiphenine HCl 10mM * 1mL in DMSO |
| Catalog Number | A11716-10mM-D |
| Alternative Name(s) | Diphenylacetic acid 2-(diethylamino)ethyl ester hydrochloride |
| Molecular Formula | C20H25NO2.HCl |
| CAS# | 50-42-0 |
| SMILES | CCN(CC)CCOC(=O)C(C1=CC=CC=C1)C2=CC=CC=C2.Cl |
| Size | 10mM * 1mL in DMSO |
| Supplier Page | http://www.adooq.com/adiphenine-hcl.html |