Clomifene citrate 10mM * 1mL in DMSO
Clomifene inhibits estrogen receptors in hypothalamus, inhibiting negative feedback of estrogen on gonadotropin release, leading to up-regulation of the hypothalamic-Cpituitary-Cadrenal axis.
| Trivial name | Clomifene citrate 10mM * 1mL in DMSO |
| Catalog Number | A10230-10mM-D |
| Alternative Name(s) | 2-(4-[2-Chloro-1,2-diphenylethenyl]phenoxy)-N,N-diethylethanamine citrate |
| Molecular Formula | C26H28ClNO.C6H8O7 |
| CAS# | 50-41-9 |
| SMILES | CCN(CC)CCOC1=CC=C(C=C1)/C(=C(/C2=CC=CC=C2)Cl)/C3=CC=CC=C3.C(C(=O)O)C(CC(=O)O)(C(=O)O)O |
| Size | 10mM * 1mL in DMSO |
| Supplier Page | http://www.adooq.com/clomifene-citrate.html |
