Hydrocortisone
Hydrocortisone is a corticosteroid hormone or glucocorticoid produced by zona fasciculata of the adrenal cortex, which is a part of the adrenal gland. It is usually referred to as the “stress hormone” as it is involved in response to stress and anxiety, controlled by corticotropin-releasing hormone (CRH). It increases blood pressure and blood sugar, and reduces immune responses. It has a role as an anti-inflammatory drug, an anti-allergic agent, an anti-asthmatic drug, a human metabolite, a mouse metabolite and a drug allergen.
Catalog Number | API50237 |
Alternative Name(s) | Cortisol Acticort Cetacort |
Research Area | APIs for Cortisones |
Molecular Formula | C21H30O5 |
CAS# | 50-23-7 |
SMILES | CC12CCC(=O)C=C1CCC3C2C(CC4(C3CCC4(C(=O)CO)O)C)O |
Size | inquiry |
Supplier Page | https://www.protheragen-ing.com/hydrocortisone-item-11340.html |