Clafen 500mg
Clafen (Cyclophosphamide) is a nitrogen mustard alkylating agent. An alkylating agent adds an alkyl group (CnH2n+1) to DNA. It attaches the alkyl group to the guanine base of DNA, at the number 7 nitrogen atom of the imidazole ring.
| Trivial name | Clafen 500mg |
| Catalog Number | A10224-500 |
| Alternative Name(s) | (RS)-N,N-bis(2-chloroethyl)-1,3,2-oxazaphosphinan-2-amine 2-oxide |
| Molecular Formula | C7H15Cl2N2O2P |
| CAS# | 50-18-0 |
| SMILES | C1CNP(=O)(OC1)N(CCCl)CCCl |
| Size | 500mg |
| Supplier Page | http://www.adooq.com/clafen-cyclophosphamide.html |
