β,β-Trehalose | MedChemExpress (MCE)
β,β-Trehalose is a analog of trehalose. β,β-Trehalose can support the growth of shoot tips of Cuscuta. β,β-Trehalose can be cleaved by nonspecific β-glucosidase[1].
| Trivial name | β,β-Trehalose |
| Catalog Number | HY-W721582 |
| Research Area | Others |
| CAS# | 499-23-0 |
| Purity | ≥98.00% |
| SMILES | OC[C@H]([C@H]([C@@H]([C@H]1O)O)O)O[C@H]1O[C@@H]2O[C@@H]([C@H]([C@@H]([C@H]2O)O)O)CO |
| PubChem Chemical Structure ID | 10783457 |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/β-β-trehalose.html |