Cenicriviroc 50mg
Cenicriviroc is an experimental drug candidate for the treatment of HIV infection.Cenicriviroc is an inhibitor of CCR2 and CCR5 receptors, allowing it to function as an entry inhibitor which prevents the virus from entering into a human cell.
| Trivial name | Cenicriviroc 50mg |
| Catalog Number | A13643-50 |
| Alternative Name(s) | 1-Benzazocine-5-carboxamide,8-[4-(2-butoxyethoxy)phenyl]-1,2,3,4-tetrahydro-1-(2-methylpropyl)-N-[4-[(S)-[(1-propyl-1H-imidazol-5-yl)methyl]sulfinyl]phenyl]- |
| Molecular Formula | C41H52N4O4S |
| CAS# | 497223-25-3 |
| SMILES | CCCCOCCOC1=CC=C(C=C1)C2=CC/3=C(C=C2)N(CCC/C(=C3)/C(=O)NC4=CC=C(C=C4)[S@@](=O)CC5=CN=CN5CCC)CC(C)C |
| Size | 50mg |
| Supplier Page | http://www.adooq.com/cenicriviroc.html |