Eltrombopag Olamine
API Standard
| Catalog Number | CS-O-01485 |
| Alternative Name(s) | Pr2Z)-2-[1-(3,4-Dimethylphenyl)-1,5-dihydro-3-methyl-5-oxo-4H-pyrazol-4-ylidene]hydrazinyl]-2'-hydroxy-[1,1'-biphenylcompd. with 2-aminoethanol |
| Research Area | Eltrombopag Olamine is the orally active ethanolamine salt of eltrombopag, a small-molecule, nonpeptide thrombopoietin receptor agonist with megakaryopoiesis-stimulating activity. Eltrombopag binds to and stimulates the transmembrane domain of the platele |
| Molecular Formula | C29H36N6O6 |
| CAS# | 496775-62-3 |
| Purity | >98% |
| SMILES | NCCO.O=C1N(C2=CC(C)=C(C)C=C2)N=C(C)/C1=N/NC(C=CC=C3C4=CC(C(O)=O)=CC=C4)=C3O.NCCO |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO01485.html |