TCS PIM-1 1 100mg
TCS PIM-1 1 is a potent and selective ATP-competitive Pim-1 kianse inhibitor with IC50 of 50 nM, displays good selectivity over Pim-2 and MEK1/MEK2(IC50s >20,000 nM).
| Trivial name | TCS PIM-1 1 100mg |
| Catalog Number | A15369-100 |
| Alternative Name(s) | 3-Cyano-4-phenyl-6-(3-bromo-6-hydroxyphenyl)-2(1H)-pyridone |
| Molecular Formula | C18H11BrN2O2 |
| CAS# | 491871-58-0 |
| SMILES | C1=CC=C(C=C1)C2=C(C(=O)NC(=C2)C3=C(C=CC(=C3)Br)O)C#N |
| Size | 100mg |
| Supplier Page | http://www.adooq.com/tcs-pim-1-1.html |
