Kaempferide
Kaempferide is an O-methylated flavonol that purified from the root of Kaempferia galangal L. and can be used as an antihypertensive agent.
| Trivial name | Kaempferol 4'-O-Methyl Ether |
| Catalog Number | CSN12354 |
| Alternative Name(s) | Kaempferol 4'-O-Methyl Ether |
| Research Area | / |
| Molecular Formula | C16H12O6 |
| CAS# | 491-54-3 |
| Purity | ≥98% |
| SMILES | O=C1C(O)=C(C2=CC=C(OC)C=C2)OC3=C1C(O)=CC(O)=C3 |
| Size | 25mg |
| Supplier Page | https://www.csnpharm.com/products/kaempferide.html |