(-)-Epicatechin
(-)-Epicatechin is a polyphenolic flavonoid that can act as an inhibitor of COX-1 (IC50 = 3.2 μM) and has activities of antioxidant, lipid-lowering and hypoglycemic, prevent cardiovascular diseases. (−)-Epicatechin is a 2R,3R stereoisomer of catechin.
| Trivial name | L-Epicatechin; (-)-Epicatechol; Epicatechin |
| Catalog Number | CSN12679 |
| Alternative Name(s) | L-Epicatechin; (-)-Epicatechol; Epicatechin |
| Research Area | / |
| Molecular Formula | C15H14O6 |
| CAS# | 490-46-0 |
| Purity | ≥98% |
| SMILES | O[C@H]1[C@@H](C2=CC=C(O)C(O)=C2)OC3=C(C(O)=CC(O)=C3)C1 |
| Size | 10mg |
| Supplier Page | https://www.csnpharm.com/products/(-)-epicatechin.html |