Robinetin
Robinetin inhibits HIV integrase cleavage and integration in a dose-dependent manne, inhibits the DNA synthesis in Proteus vulgaris, and the RNA synthesis in S. aureus, also inhibits egg yolk phosphatidylcholine (EYPC) membrane lipid peroxidation and hemoglobin A (HbA) glycosylation with high efficiency.
| Trivial name | 3,3',4',5',7-Pentahydroxyflavone |
| Catalog Number | E0459 |
| Molecular Formula | C15H10O7 |
| CAS# | 490-31-3 |
| SMILES | OC1=CC=C2C(=O)C(=C(OC2=C1)C3=CC(=C(O)C(=C3)O)O)O |
| Size | 5mg |
| Supplier Page | http://www.selleckchem.com/products/robinetin.html |
| Additional Information | https://file.selleck.cn/downloads/struct/e0459-robinetin-chemical-structure.gif |