β-Maaliene | MedChemExpress (MCE)
β-Maaliene can be isolated from the fresh leaves of Vitex densiflora (Maaliene) and is the main component in the isolate. β-Maaliene can significantly reduce the exercise capacity of mice at certain doses[1].
| Trivial name | β-Maaliene |
| Catalog Number | HY-N11972 |
| Research Area | Neurological Disease |
| CAS# | 489-29-2 |
| Purity | ≥98.00% |
| SMILES | CC1([C@@]2([H])C3=C(C)CCC[C@]3(CC[C@]21[H])C)C |
| PubChem Chemical Structure ID | 101596917 |
| Size | 0.02 mL |
| Supplier Page | https://www.medchemexpress.com/β-maaliene.html |