L-Iditol
Carbohydrates
| Trivial name | NULL |
| Catalog Number | CS-T-56585 |
| Alternative Name(s) | Iditol;Sorbitol Impurity B ;(2S,3R,4R,5S)-hexane-1,2,3,4,5,6-hexaol |
| Research Area | Occurs naturally along with D-Glucitol in plants, including in the berry of mountain ash (Sorbus aucuparia). Allitol, D-talitol and L-iditol are sugar alcohols that are rare in nature. |
| Molecular Formula | C6H14O6 |
| CAS# | 488-45-9 |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | O[C@H]([C@@H](O)CO)[C@H](O)[C@@H](O)CO |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CST56585.html |
| Additional Information | NULL |