Citropten
Citropten, a natural product isolated and purified from the peel of Citrus medica L., has interactions with human malignant melanoma A-2058 cells which are exposed to them.
| Trivial name | 5,7-Dimethoxycoumarin; Citroptene; Limettin; Limetin |
| Catalog Number | CSN10014 |
| Alternative Name(s) | 5,7-Dimethoxycoumarin; Citroptene; Limettin; Limetin |
| Research Area | / |
| Molecular Formula | C11H10O4 |
| CAS# | 487-06-9 |
| Purity | ≥95% |
| SMILES | O=C1OC2=C(C(OC)=CC(OC)=C2)C=C1 |
| Size | 250mg |
| Supplier Page | https://www.csnpharm.com/products/citropten.html |