Daidzein 10mM * 1mL in DMSO
Daidzein structurally belongs to the group of isoflavones. Daidzein can be converted to its end metabolite S-equol in some humans based on the presence of certain intestinal bacteria. Based on several decades of research, S-equol has potential for significant health benefits.
| Trivial name | Daidzein 10mM * 1mL in DMSO |
| Catalog Number | A10282-10mM-D |
| Alternative Name(s) | 7-Hydroxy-3-(4-hydroxyphenyl) chromen-4-one |
| Molecular Formula | C15H10O4 |
| CAS# | 486-66-8 |
| SMILES | C1=CC(=CC=C1C2=COC3=C(C2=O)C=CC(=C3)O)O |
| Size | 10mM * 1mL in DMSO |
| Supplier Page | http://www.adooq.com/daidzein.html |