Bergaptol
Bergaptol is a hydroxylated psoralen isolated and purified from the root of Notopterygium incisum that acts as a potent inhibitor of debenzylation activity of CYP3A4 enzyme with an IC50 value of 24.92 μM.
| Trivial name | 5-Hydroxypsoralen |
| Catalog Number | CSN10419 |
| Alternative Name(s) | 5-Hydroxypsoralen |
| Research Area | Cancer |
| Molecular Formula | C11H6O4 |
| CAS# | 486-60-2 |
| Purity | ≥98% |
| SMILES | O=C1C=CC2=C(O1)C=C(OC=C3)C3=C2O |
| Size | 25mg |
| Supplier Page | https://www.csnpharm.com/products/bergaptol.html |