Bergaptol
API Standards
| Trivial name | NULL |
| Catalog Number | CS-T-06364 |
| Alternative Name(s) | 4-Hydroxy-7H-furo[3,2-g][1]benzopyran-7-one |
| Research Area | A hydroxylated psoralen that acts as a potent inhibitors of debenzylation activity of CYP3A4 enzyme with an IC50 value of 24.92 and 42.93 µM, respectively. Recent studies suggest that it may have antiproliferative and anticancer properties. |
| Molecular Formula | C11H6O4 |
| CAS# | 486-60-2 |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | O=C1C=CC2=C(O)C3=C(OC=C3)C=C2O1 |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CST06364.html |
| Additional Information | NULL |