(+)-Bicuculline
Ionotropic GABAA receptors are ligand-gated ion channels that facilitate the passing of chloride ions across the cell membrane and promote an inhibitory influence on target neurons. These receptors are the major targets for benzodiazepines and related anxiolytic drugs.
| Catalog Number | 485-49-4 |
| Alternative Name(s) | Bicculine; Bicucullin; BRN 0098786; NSC 32192; BRN0098786; NSC32192; BRN-0098786; NSC-32192 |
| Molecular Formula | C20H17NO6 |
| CAS# | 485-49-4 |
| Purity | 98% |
| Inchi | InChI=1S/C20H17NO6/c1-21-5-4-10-6-14-15(25-8-24-14)7-12(10)17(21)18-11-2-3-13-19(26-9-23-13)16(11)20(22)27-18/h2-3,6-7,17-18H,4-5,8-9H2,1H3/t17-,18+/m0/s1 |
| Inchi Key | IYGYMKDQCDOMRE-ZWKOTPCHSA-N |
| Size | Please inquire |
| Supplier Page | https://www.bocsci.com/product/bicuculline-cas-485-49-4-92982.html |
